About 3-(iodomethyl)hexanoic acid
3-(iodomethyl)hexanoic acid (PubChem CID 45358746) has the molecular formula C7H13IO2
and a molecular weight of 256.08 g/mol. Its IUPAC name is 3-(iodomethyl)hexanoic acid.
Molecular Properties
| Compound Name | 3-(iodomethyl)hexanoic acid |
| PubChem CID | 45358746 |
| Molecular Formula | C7H13IO2 |
| Molecular Weight | 256.08 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | 3-(iodomethyl)hexanoic acid |
| SMILES | CCCC(CI)CC(=O)O |
| InChI | InChI=1S/C7H13IO2/c1-2-3-6(5-8)4-7(9)10/h6H,2-5H2,1H3,(H,9,10) |
| InChIKey | MIYUTMZDGYBCOY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.08 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(iodomethyl)hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(iodomethyl)hexanoic acid?
The IUPAC name of 3-(iodomethyl)hexanoic acid (CID 45358746) is 3-(iodomethyl)hexanoic acid.
What is the SMILES notation for 3-(iodomethyl)hexanoic acid?
The canonical SMILES for 3-(iodomethyl)hexanoic acid is CCCC(CI)CC(=O)O.
What is the InChIKey of 3-(iodomethyl)hexanoic acid?
The InChIKey is MIYUTMZDGYBCOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13IO2/c1-2-3-6(5-8)4-7(9)10/h6H,2-5H2,1H3,(H,9,10).
What are the key properties of 3-(iodomethyl)hexanoic acid?
3-(iodomethyl)hexanoic acid has a molecular weight of 256.08 g/mol, XLogP of 2.31, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(iodomethyl)hexanoic acid is sourced from PubChem (CID 45358746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).