C22H17F3N6 — CID 143020099
3-[4-[(2E,4Z)-1,6-difluoroocta-2,4,7-trien-2-yl]-1,2,4-triazol-3-yl]-5-(6-fluoro-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 143020099) has the molecular formula C22H17F3N6 and a molecular weight of 422.41 g/mol. Its IUPAC name is 3-[4-[(2E,4Z)-1,6-difluoroocta-2,4,7-trien-2-yl]-1,2,4-triazol-3-yl]-5-(6-fluoro-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[4-[(2E,4Z)-1,6-difluoroocta-2,4,7-trien-2-yl]-1,2,4-triazol-3-yl]-5-(6-fluoro-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 143020099 |
| Molecular Formula | C22H17F3N6 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 3-[4-[(2E,4Z)-1,6-difluoroocta-2,4,7-trien-2-yl]-1,2,4-triazol-3-yl]-5-(6-fluoro-3-pyridinyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C=CC(F)/C=C\C=C(/CF)n1cnnc1-c1c[nH]c2ncc(-c3ccc(F)nc3)cc12 |
| InChI | InChI=1S/C22H17F3N6/c1-2-16(24)4-3-5-17(9-23)31-13-29-30-22(31)19-12-28-21-18(19)8-15(11-27-21)14-6-7-20(25)26-10-14/h2-8,10-13,16H,1,9H2,(H,27,28)/b4-3-,17-5+ |
| InChIKey | KGTRPDCSBYIASY-XCMKXHSXSA-N |
| XLogP | 4.91 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|