C19H14FN3O2 — CID 145491751
[5-[3-(2-fluorophenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]methanediol (PubChem CID 145491751) has the molecular formula C19H14FN3O2 and a molecular weight of 335.34 g/mol. Its IUPAC name is [5-[3-(2-fluorophenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]methanediol.
| Compound Name | [5-[3-(2-fluorophenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]methanediol |
|---|---|
| PubChem CID | 145491751 |
| Molecular Formula | C19H14FN3O2 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | [5-[3-(2-fluorophenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-pyridinyl]methanediol |
| SMILES | OC(O)c1cncc(-c2cnc3[nH]cc(-c4ccccc4F)c3c2)c1 |
| InChI | InChI=1S/C19H14FN3O2/c20-17-4-2-1-3-14(17)16-10-23-18-15(16)6-12(9-22-18)11-5-13(19(24)25)8-21-7-11/h1-10,19,24-25H,(H,22,23) |
| InChIKey | RKQLAZSYQLLGOV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|