C15H9FN2 — CID 88956542
3-ethynyl-5-(2-fluorophenyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 88956542) has the molecular formula C15H9FN2 and a molecular weight of 236.25 g/mol. Its IUPAC name is 3-ethynyl-5-(2-fluorophenyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-ethynyl-5-(2-fluorophenyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 88956542 |
| Molecular Formula | C15H9FN2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 3-ethynyl-5-(2-fluorophenyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C#Cc1c[nH]c2ncc(-c3ccccc3F)cc12 |
| InChI | InChI=1S/C15H9FN2/c1-2-10-8-17-15-13(10)7-11(9-18-15)12-5-3-4-6-14(12)16/h1,3-9H,(H,17,18) |
| InChIKey | QYZOHQBUOAEMAH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|