N-methyl-3-oxocyclopentane-1-carboxamide;molecular hydrogen

C7H13NO2 — CID 143021047

IUPACN-methyl-3-oxocyclopentane-1-carboxamide;molecular hydrogen
SMILESCNC(=O)C1CCC(=O)C1.[H][H]
InChIInChI=1S/C7H11NO2.H2/c1-8-7(10)5-2-3-6(9)4-5;/h5H,2-4H2,1H3,(H,8,10);1H
InChIKeyQNMCRFDTRJTMRR-UHFFFAOYSA-N
MW143.19 g/mol
LogP0.35
Rot. Bonds1

About N-methyl-3-oxocyclopentane-1-carboxamide;molecular hydrogen

N-methyl-3-oxocyclopentane-1-carboxamide;molecular hydrogen (PubChem CID 143021047) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is N-methyl-3-oxocyclopentane-1-carboxamide;molecular hydrogen.

Molecular Properties

Compound NameN-methyl-3-oxocyclopentane-1-carboxamide;molecular hydrogen
PubChem CID143021047
Molecular FormulaC7H13NO2
Molecular Weight143.19 g/mol
Exact Mass143.09
IUPAC NameN-methyl-3-oxocyclopentane-1-carboxamide;molecular hydrogen
SMILESCNC(=O)C1CCC(=O)C1.[H][H]
InChIInChI=1S/C7H11NO2.H2/c1-8-7(10)5-2-3-6(9)4-5;/h5H,2-4H2,1H3,(H,8,10);1H
InChIKeyQNMCRFDTRJTMRR-UHFFFAOYSA-N
XLogP0.35
TPSA46.17 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.19
LogP ≤ 50.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze N-methyl-3-oxocyclopentane-1-carboxamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-methyl-3-oxocyclopentane-1-carboxamide;molecular hydrogen?
The IUPAC name of N-methyl-3-oxocyclopentane-1-carboxamide;molecular hydrogen (CID 143021047) is N-methyl-3-oxocyclopentane-1-carboxamide;molecular hydrogen.
What is the SMILES notation for N-methyl-3-oxocyclopentane-1-carboxamide;molecular hydrogen?
The canonical SMILES for N-methyl-3-oxocyclopentane-1-carboxamide;molecular hydrogen is CNC(=O)C1CCC(=O)C1.[H][H].
What is the InChIKey of N-methyl-3-oxocyclopentane-1-carboxamide;molecular hydrogen?
The InChIKey is QNMCRFDTRJTMRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2.H2/c1-8-7(10)5-2-3-6(9)4-5;/h5H,2-4H2,1H3,(H,8,10);1H.
What are the key properties of N-methyl-3-oxocyclopentane-1-carboxamide;molecular hydrogen?
N-methyl-3-oxocyclopentane-1-carboxamide;molecular hydrogen has a molecular weight of 143.19 g/mol, XLogP of 0.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-oxocyclopentane-1-carboxamide;molecular hydrogen is sourced from PubChem (CID 143021047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).