C6H14N2O2 — CID 159147898
(2S)-N-methyl-5-oxopyrrolidine-2-carboxamide;molecular hydrogen (PubChem CID 159147898) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is (2S)-N-methyl-5-oxopyrrolidine-2-carboxamide;molecular hydrogen.
| Compound Name | (2S)-N-methyl-5-oxopyrrolidine-2-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 159147898 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (2S)-N-methyl-5-oxopyrrolidine-2-carboxamide;molecular hydrogen |
| SMILES | CNC(=O)[C@@H]1CCC(=O)N1.[H][H].[H][H] |
| InChI | InChI=1S/C6H10N2O2.2H2/c1-7-6(10)4-2-3-5(9)8-4;;/h4H,2-3H2,1H3,(H,7,10)(H,8,9);2*1H/t4-;;/m0../s1 |
| InChIKey | KIXMMDIFVOIVMW-FHNDMYTFSA-N |
| XLogP | -0.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |