C7H10N2O2 — CID 154093786
(2S)-N-ethenyl-5-oxopyrrolidine-2-carboxamide (PubChem CID 154093786) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is (2S)-N-ethenyl-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-ethenyl-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 154093786 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | (2S)-N-ethenyl-5-oxopyrrolidine-2-carboxamide |
| SMILES | C=CNC(=O)[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C7H10N2O2/c1-2-8-7(11)5-3-4-6(10)9-5/h2,5H,1,3-4H2,(H,8,11)(H,9,10)/t5-/m0/s1 |
| InChIKey | QHJTVEORHLVBLR-YFKPBYRVSA-N |
| XLogP | -0.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |