C16H17N3O3 — CID 143021884
2-(oxan-4-yl)quinoline-3,6-dicarboxamide (PubChem CID 143021884) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-(oxan-4-yl)quinoline-3,6-dicarboxamide.
| Compound Name | 2-(oxan-4-yl)quinoline-3,6-dicarboxamide |
|---|---|
| PubChem CID | 143021884 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-(oxan-4-yl)quinoline-3,6-dicarboxamide |
| SMILES | NC(=O)c1ccc2nc(C3CCOCC3)c(C(N)=O)cc2c1 |
| InChI | InChI=1S/C16H17N3O3/c17-15(20)10-1-2-13-11(7-10)8-12(16(18)21)14(19-13)9-3-5-22-6-4-9/h1-2,7-9H,3-6H2,(H2,17,20)(H2,18,21) |
| InChIKey | HJCFEUSSIMMSIP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |