C20H27N3O2S — CID 143022700
3-(hexanoylamino)-N-(5-methyl-2-pyridinyl)thiophene-2-carboxamide;prop-1-ene (PubChem CID 143022700) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 3-(hexanoylamino)-N-(5-methyl-2-pyridinyl)thiophene-2-carboxamide;prop-1-ene.
| Compound Name | 3-(hexanoylamino)-N-(5-methyl-2-pyridinyl)thiophene-2-carboxamide;prop-1-ene |
|---|---|
| PubChem CID | 143022700 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 3-(hexanoylamino)-N-(5-methyl-2-pyridinyl)thiophene-2-carboxamide;prop-1-ene |
| SMILES | C=CC.CCCCCC(=O)Nc1ccsc1C(=O)Nc1ccc(C)cn1 |
| InChI | InChI=1S/C17H21N3O2S.C3H6/c1-3-4-5-6-15(21)19-13-9-10-23-16(13)17(22)20-14-8-7-12(2)11-18-14;1-3-2/h7-11H,3-6H2,1-2H3,(H,19,21)(H,18,20,22);3H,1H2,2H3 |
| InChIKey | VDBVKJQXASWZHZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|