C24H26BrN5O2S — CID 89063527
N-(5-bromo-2-pyridinyl)-3-[[4-(N-methyl-N-pentylcarbamimidoyl)benzoyl]amino]thiophene-2-carboxamide (PubChem CID 89063527) has the molecular formula C24H26BrN5O2S and a molecular weight of 528.48 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-3-[[4-(N-methyl-N-pentylcarbamimidoyl)benzoyl]amino]thiophene-2-carboxamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-3-[[4-(N-methyl-N-pentylcarbamimidoyl)benzoyl]amino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 89063527 |
| Molecular Formula | C24H26BrN5O2S |
| Molecular Weight | 528.48 g/mol |
| Exact Mass | 527.10 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-3-[[4-(N-methyl-N-pentylcarbamimidoyl)benzoyl]amino]thiophene-2-carboxamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccsc2C(=O)Nc2ccc(Br)cn2)cc1)N(C)CCCCC |
| InChI | InChI=1S/C24H26BrN5O2S/c1-3-4-5-13-30(2)22(26)16-6-8-17(9-7-16)23(31)28-19-12-14-33-21(19)24(32)29-20-11-10-18(25)15-27-20/h6-12,14-15,26H,3-5,13H2,1-2H3,(H,28,31)(H,27,29,32)/b26-22- |
| InChIKey | MUXCYUQBSALCDM-ROMGYVFFSA-N |
| XLogP | 5.86 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|