C16H24O2 — CID 143024753
5-cyclohexa-1,3-dien-1-yl-2-ethoxy-5-methylhept-1-en-3-one (PubChem CID 143024753) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 5-cyclohexa-1,3-dien-1-yl-2-ethoxy-5-methylhept-1-en-3-one.
| Compound Name | 5-cyclohexa-1,3-dien-1-yl-2-ethoxy-5-methylhept-1-en-3-one |
|---|---|
| PubChem CID | 143024753 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 5-cyclohexa-1,3-dien-1-yl-2-ethoxy-5-methylhept-1-en-3-one |
| SMILES | C=C(OCC)C(=O)CC(C)(CC)C1=CC=CCC1 |
| InChI | InChI=1S/C16H24O2/c1-5-16(4,14-10-8-7-9-11-14)12-15(17)13(3)18-6-2/h7-8,10H,3,5-6,9,11-12H2,1-2,4H3 |
| InChIKey | KEYSQVSGWMGNHQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|