C18H24O3 — CID 142949704
2-[2-methyl-6-(3-methylbuta-1,3-dien-2-yloxy)hexan-2-yl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 142949704) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-[2-methyl-6-(3-methylbuta-1,3-dien-2-yloxy)hexan-2-yl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[2-methyl-6-(3-methylbuta-1,3-dien-2-yloxy)hexan-2-yl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 142949704 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-[2-methyl-6-(3-methylbuta-1,3-dien-2-yloxy)hexan-2-yl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | C=C(C)C(=C)OCCCCC(C)(C)C1=CC(=O)C=CC1=O |
| InChI | InChI=1S/C18H24O3/c1-13(2)14(3)21-11-7-6-10-18(4,5)16-12-15(19)8-9-17(16)20/h8-9,12H,1,3,6-7,10-11H2,2,4-5H3 |
| InChIKey | OZWQYQAWOXBKHV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|