C18H30O5 — CID 58836413
tert-butyl 2-acetyl-2-methyl-7-(2-methylprop-2-enoyloxy)heptanoate (PubChem CID 58836413) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is tert-butyl 2-acetyl-2-methyl-7-(2-methylprop-2-enoyloxy)heptanoate.
| Compound Name | tert-butyl 2-acetyl-2-methyl-7-(2-methylprop-2-enoyloxy)heptanoate |
|---|---|
| PubChem CID | 58836413 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | tert-butyl 2-acetyl-2-methyl-7-(2-methylprop-2-enoyloxy)heptanoate |
| SMILES | C=C(C)C(=O)OCCCCCC(C)(C(C)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H30O5/c1-13(2)15(20)22-12-10-8-9-11-18(7,14(3)19)16(21)23-17(4,5)6/h1,8-12H2,2-7H3 |
| InChIKey | BEJHWUNQAWBSAO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|