C30H43NO5 — CID 143024817
(8S,10S,15Z,18R)-7-hydroxy-3-methyl-12-[(E)-3-(4-methyl-3,6-dihydro-2H-pyran-2-yl)prop-2-enyl]-5-methylidene-9,22-dioxa-13-azatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one (PubChem CID 143024817) has the molecular formula C30H43NO5 and a molecular weight of 497.68 g/mol. Its IUPAC name is (8S,10S,15Z,18R)-7-hydroxy-3-methyl-12-[(E)-3-(4-methyl-3,6-dihydro-2H-pyran-2-yl)prop-2-enyl]-5-methylidene-9,22-dioxa-13-azatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one.
| Compound Name | (8S,10S,15Z,18R)-7-hydroxy-3-methyl-12-[(E)-3-(4-methyl-3,6-dihydro-2H-pyran-2-yl)prop-2-enyl]-5-methylidene-9,22-dioxa-13-azatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one |
|---|---|
| PubChem CID | 143024817 |
| Molecular Formula | C30H43NO5 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.31 |
| IUPAC Name | (8S,10S,15Z,18R)-7-hydroxy-3-methyl-12-[(E)-3-(4-methyl-3,6-dihydro-2H-pyran-2-yl)prop-2-enyl]-5-methylidene-9,22-dioxa-13-azatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one |
| SMILES | C=C1CC(C)CC2CC=C[C@@H](C/C=C/C(=O)NC(C/C=C/C3CC(C)=CCO3)C[C@@H]3O[C@H]3C(O)C1)O2 |
| InChI | InChI=1S/C30H43NO5/c1-20-13-14-34-25(16-20)10-4-7-23-19-28-30(36-28)27(32)18-22(3)15-21(2)17-26-11-5-8-24(35-26)9-6-12-29(33)31-23/h4-6,8,10,12-13,21,23-28,30,32H,3,7,9,11,14-19H2,1-2H3,(H,31,33)/b10-4+,12-6+/t21?,23?,24-,25?,26?,27?,28-,30-/m0/s1 |
| InChIKey | PJSCSXOQDUPBEU-UUCCIWMLSA-N |
| XLogP | 4.71 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|