C25H43N3O6 — CID 143025331
tert-butyl N-[(3S,13S,16S,17R)-13-formyl-2,15-dioxo-17-propan-2-yl-5-oxa-1,14-diazabicyclo[14.3.0]nonadecan-3-yl]carbamate (PubChem CID 143025331) has the molecular formula C25H43N3O6 and a molecular weight of 481.63 g/mol. Its IUPAC name is tert-butyl N-[(3S,13S,16S,17R)-13-formyl-2,15-dioxo-17-propan-2-yl-5-oxa-1,14-diazabicyclo[14.3.0]nonadecan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,13S,16S,17R)-13-formyl-2,15-dioxo-17-propan-2-yl-5-oxa-1,14-diazabicyclo[14.3.0]nonadecan-3-yl]carbamate |
|---|---|
| PubChem CID | 143025331 |
| Molecular Formula | C25H43N3O6 |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.32 |
| IUPAC Name | tert-butyl N-[(3S,13S,16S,17R)-13-formyl-2,15-dioxo-17-propan-2-yl-5-oxa-1,14-diazabicyclo[14.3.0]nonadecan-3-yl]carbamate |
| SMILES | CC(C)[C@H]1CCN2C(=O)[C@@H](NC(=O)OC(C)(C)C)COCCCCCCC[C@@H](C=O)NC(=O)[C@H]12 |
| InChI | InChI=1S/C25H43N3O6/c1-17(2)19-12-13-28-21(19)22(30)26-18(15-29)11-9-7-6-8-10-14-33-16-20(23(28)31)27-24(32)34-25(3,4)5/h15,17-21H,6-14,16H2,1-5H3,(H,26,30)(H,27,32)/t18-,19+,20-,21-/m0/s1 |
| InChIKey | OMFYQWLGQBMNAT-WOZUAGRISA-N |
| XLogP | 2.81 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|