C28H48N4O7 — CID 88971959
tert-butyl N-[(3S,13S,16S,18R)-18-ethyl-13-[1-hydroxy-2-oxo-2-(prop-2-enylamino)ethyl]-2,15-dioxo-5-oxa-1,14-diazabicyclo[14.3.0]nonadecan-3-yl]carbamate (PubChem CID 88971959) has the molecular formula C28H48N4O7 and a molecular weight of 552.71 g/mol. Its IUPAC name is tert-butyl N-[(3S,13S,16S,18R)-18-ethyl-13-[1-hydroxy-2-oxo-2-(prop-2-enylamino)ethyl]-2,15-dioxo-5-oxa-1,14-diazabicyclo[14.3.0]nonadecan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,13S,16S,18R)-18-ethyl-13-[1-hydroxy-2-oxo-2-(prop-2-enylamino)ethyl]-2,15-dioxo-5-oxa-1,14-diazabicyclo[14.3.0]nonadecan-3-yl]carbamate |
|---|---|
| PubChem CID | 88971959 |
| Molecular Formula | C28H48N4O7 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | tert-butyl N-[(3S,13S,16S,18R)-18-ethyl-13-[1-hydroxy-2-oxo-2-(prop-2-enylamino)ethyl]-2,15-dioxo-5-oxa-1,14-diazabicyclo[14.3.0]nonadecan-3-yl]carbamate |
| SMILES | C=CCNC(=O)C(O)[C@@H]1CCCCCCCOC[C@H](NC(=O)OC(C)(C)C)C(=O)N2C[C@H](CC)C[C@H]2C(=O)N1 |
| InChI | InChI=1S/C28H48N4O7/c1-6-14-29-25(35)23(33)20-13-11-9-8-10-12-15-38-18-21(31-27(37)39-28(3,4)5)26(36)32-17-19(7-2)16-22(32)24(34)30-20/h6,19-23,33H,1,7-18H2,2-5H3,(H,29,35)(H,30,34)(H,31,37)/t19-,20+,21+,22+,23?/m1/s1 |
| InChIKey | IGMXLKWXYOJUJT-RTRRTDFASA-N |
| XLogP | 2.03 |
| TPSA | 146.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|