C17H20FNO — CID 143025696
(3Z,5E,7Z,9E)-7-amino-10-(3-fluorophenyl)undeca-3,5,7,9-tetraen-2-ol (PubChem CID 143025696) has the molecular formula C17H20FNO and a molecular weight of 273.35 g/mol. Its IUPAC name is (3Z,5E,7Z,9E)-7-amino-10-(3-fluorophenyl)undeca-3,5,7,9-tetraen-2-ol.
| Compound Name | (3Z,5E,7Z,9E)-7-amino-10-(3-fluorophenyl)undeca-3,5,7,9-tetraen-2-ol |
|---|---|
| PubChem CID | 143025696 |
| Molecular Formula | C17H20FNO |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (3Z,5E,7Z,9E)-7-amino-10-(3-fluorophenyl)undeca-3,5,7,9-tetraen-2-ol |
| SMILES | C/C(=C\C=C(N)\C=C\C=C/C(C)O)c1cccc(F)c1 |
| InChI | InChI=1S/C17H20FNO/c1-13(15-7-5-8-16(18)12-15)10-11-17(19)9-4-3-6-14(2)20/h3-12,14,20H,19H2,1-2H3/b6-3-,9-4+,13-10+,17-11- |
| InChIKey | FQPXTGNCUQGMHI-PJDVWPJXSA-N |
| XLogP | 3.56 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|