C13H15NO2 — CID 56624458
3-benzyl-4-(methoxyamino)cyclopenta-2,4-dien-1-ol (PubChem CID 56624458) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-benzyl-4-(methoxyamino)cyclopenta-2,4-dien-1-ol.
| Compound Name | 3-benzyl-4-(methoxyamino)cyclopenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 56624458 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 3-benzyl-4-(methoxyamino)cyclopenta-2,4-dien-1-ol |
| SMILES | CONC1=CC(O)C=C1Cc1ccccc1 |
| InChI | InChI=1S/C13H15NO2/c1-16-14-13-9-12(15)8-11(13)7-10-5-3-2-4-6-10/h2-6,8-9,12,14-15H,7H2,1H3 |
| InChIKey | WZYAWCOVOMHJOJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|