C10H11NO2 — CID 54227131
(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)methanol (PubChem CID 54227131) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is (3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)methanol.
| Compound Name | (3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)methanol |
|---|---|
| PubChem CID | 54227131 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)methanol |
| SMILES | OCC1C=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C10H11NO2/c12-7-9-6-10(11-13-9)8-4-2-1-3-5-8/h1-6,9,11-12H,7H2 |
| InChIKey | QGQIOVXSHXRWON-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |