C10H9FINO2 — CID 91060512
[3-(3-fluoro-4-iodophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol (PubChem CID 91060512) has the molecular formula C10H9FINO2 and a molecular weight of 321.09 g/mol. Its IUPAC name is [3-(3-fluoro-4-iodophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol.
| Compound Name | [3-(3-fluoro-4-iodophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol |
|---|---|
| PubChem CID | 91060512 |
| Molecular Formula | C10H9FINO2 |
| Molecular Weight | 321.09 g/mol |
| Exact Mass | 320.97 |
| IUPAC Name | [3-(3-fluoro-4-iodophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methanol |
| SMILES | OCC1C=C(c2ccc(I)c(F)c2)NO1 |
| InChI | InChI=1S/C10H9FINO2/c11-8-3-6(1-2-9(8)12)10-4-7(5-14)15-13-10/h1-4,7,13-14H,5H2 |
| InChIKey | WXOMVKBNZUAGCG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.09 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|