C11H11FINO4S — CID 91242729
[3-(3-fluoro-4-iodophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl methanesulfonate (PubChem CID 91242729) has the molecular formula C11H11FINO4S and a molecular weight of 399.18 g/mol. Its IUPAC name is [3-(3-fluoro-4-iodophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl methanesulfonate.
| Compound Name | [3-(3-fluoro-4-iodophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 91242729 |
| Molecular Formula | C11H11FINO4S |
| Molecular Weight | 399.18 g/mol |
| Exact Mass | 398.94 |
| IUPAC Name | [3-(3-fluoro-4-iodophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1C=C(c2ccc(I)c(F)c2)NO1 |
| InChI | InChI=1S/C11H11FINO4S/c1-19(15,16)17-6-8-5-11(14-18-8)7-2-3-10(13)9(12)4-7/h2-5,8,14H,6H2,1H3 |
| InChIKey | OKGZRJWNGZQGTR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|