C13H8F6N2O2 — CID 91143620
4-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,5-dihydro-1,2-oxazol-3-yl]benzonitrile (PubChem CID 91143620) has the molecular formula C13H8F6N2O2 and a molecular weight of 338.21 g/mol. Its IUPAC name is 4-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,5-dihydro-1,2-oxazol-3-yl]benzonitrile.
| Compound Name | 4-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,5-dihydro-1,2-oxazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 91143620 |
| Molecular Formula | C13H8F6N2O2 |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 4-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,5-dihydro-1,2-oxazol-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(C2=CC(C(O)(C(F)(F)F)C(F)(F)F)ON2)cc1 |
| InChI | InChI=1S/C13H8F6N2O2/c14-12(15,16)11(22,13(17,18)19)10-5-9(21-23-10)8-3-1-7(6-20)2-4-8/h1-5,10,21-22H |
| InChIKey | RPHBQHYZDFLFIH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |