C10H8N2O — CID 57240771
4-(2,5-dihydro-1,2-oxazol-3-yl)benzonitrile (PubChem CID 57240771) has the molecular formula C10H8N2O and a molecular weight of 172.19 g/mol. Its IUPAC name is 4-(2,5-dihydro-1,2-oxazol-3-yl)benzonitrile.
| Compound Name | 4-(2,5-dihydro-1,2-oxazol-3-yl)benzonitrile |
|---|---|
| PubChem CID | 57240771 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 4-(2,5-dihydro-1,2-oxazol-3-yl)benzonitrile |
| SMILES | N#Cc1ccc(C2=CCON2)cc1 |
| InChI | InChI=1S/C10H8N2O/c11-7-8-1-3-9(4-2-8)10-5-6-13-12-10/h1-5,12H,6H2 |
| InChIKey | RDONSEXWBPABQT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |