C11H10N2O — CID 57036077
2-(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)acetonitrile (PubChem CID 57036077) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)acetonitrile.
| Compound Name | 2-(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)acetonitrile |
|---|---|
| PubChem CID | 57036077 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)acetonitrile |
| SMILES | N#CCC1C=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C11H10N2O/c12-7-6-10-8-11(13-14-10)9-4-2-1-3-5-9/h1-5,8,10,13H,6H2 |
| InChIKey | YKAALUFLZKDTJJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |