C11H10N2OS — CID 56980359
5-(isothiocyanatomethyl)-3-phenyl-2,5-dihydro-1,2-oxazole (PubChem CID 56980359) has the molecular formula C11H10N2OS and a molecular weight of 218.28 g/mol. Its IUPAC name is 5-(isothiocyanatomethyl)-3-phenyl-2,5-dihydro-1,2-oxazole.
| Compound Name | 5-(isothiocyanatomethyl)-3-phenyl-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 56980359 |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 5-(isothiocyanatomethyl)-3-phenyl-2,5-dihydro-1,2-oxazole |
| SMILES | S=C=NCC1C=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C11H10N2OS/c15-8-12-7-10-6-11(13-14-10)9-4-2-1-3-5-9/h1-6,10,13H,7H2 |
| InChIKey | NMKZGRMLDNYNDM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|