C12H9F3N2OS — CID 56982316
5-(isothiocyanatomethyl)-3-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole (PubChem CID 56982316) has the molecular formula C12H9F3N2OS and a molecular weight of 286.28 g/mol. Its IUPAC name is 5-(isothiocyanatomethyl)-3-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole.
| Compound Name | 5-(isothiocyanatomethyl)-3-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 56982316 |
| Molecular Formula | C12H9F3N2OS |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 5-(isothiocyanatomethyl)-3-[4-(trifluoromethyl)phenyl]-2,5-dihydro-1,2-oxazole |
| SMILES | FC(F)(F)c1ccc(C2=CC(CN=C=S)ON2)cc1 |
| InChI | InChI=1S/C12H9F3N2OS/c13-12(14,15)9-3-1-8(2-4-9)11-5-10(18-17-11)6-16-7-19/h1-5,10,17H,6H2 |
| InChIKey | FVFSCLHFPNVWIG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|