C10H12N2O — CID 57170219
(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)methanamine (PubChem CID 57170219) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is (3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)methanamine.
| Compound Name | (3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)methanamine |
|---|---|
| PubChem CID | 57170219 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | (3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)methanamine |
| SMILES | NCC1C=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C10H12N2O/c11-7-9-6-10(12-13-9)8-4-2-1-3-5-8/h1-6,9,12H,7,11H2 |
| InChIKey | RBXFZVGHUHCHDQ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |