C17H14N2OS — CID 57090427
5-(isothiocyanatomethyl)-3-(4-phenylphenyl)-2,5-dihydro-1,2-oxazole (PubChem CID 57090427) has the molecular formula C17H14N2OS and a molecular weight of 294.38 g/mol. Its IUPAC name is 5-(isothiocyanatomethyl)-3-(4-phenylphenyl)-2,5-dihydro-1,2-oxazole.
| Compound Name | 5-(isothiocyanatomethyl)-3-(4-phenylphenyl)-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 57090427 |
| Molecular Formula | C17H14N2OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 5-(isothiocyanatomethyl)-3-(4-phenylphenyl)-2,5-dihydro-1,2-oxazole |
| SMILES | S=C=NCC1C=C(c2ccc(-c3ccccc3)cc2)NO1 |
| InChI | InChI=1S/C17H14N2OS/c21-12-18-11-16-10-17(19-20-16)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-10,16,19H,11H2 |
| InChIKey | GJBAUAMBWGWOTD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|