C11H9N3O3S — CID 56977632
5-(isothiocyanatomethyl)-3-(4-nitrophenyl)-2,5-dihydro-1,2-oxazole (PubChem CID 56977632) has the molecular formula C11H9N3O3S and a molecular weight of 263.28 g/mol. Its IUPAC name is 5-(isothiocyanatomethyl)-3-(4-nitrophenyl)-2,5-dihydro-1,2-oxazole.
| Compound Name | 5-(isothiocyanatomethyl)-3-(4-nitrophenyl)-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 56977632 |
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 5-(isothiocyanatomethyl)-3-(4-nitrophenyl)-2,5-dihydro-1,2-oxazole |
| SMILES | O=[N+]([O-])c1ccc(C2=CC(CN=C=S)ON2)cc1 |
| InChI | InChI=1S/C11H9N3O3S/c15-14(16)9-3-1-8(2-4-9)11-5-10(17-13-11)6-12-7-18/h1-5,10,13H,6H2 |
| InChIKey | NPAJAAPNLWRUFT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|