C13H17NO — CID 57079399
5-butyl-3-phenyl-2,5-dihydro-1,2-oxazole (PubChem CID 57079399) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 5-butyl-3-phenyl-2,5-dihydro-1,2-oxazole.
| Compound Name | 5-butyl-3-phenyl-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 57079399 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 5-butyl-3-phenyl-2,5-dihydro-1,2-oxazole |
| SMILES | CCCCC1C=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C13H17NO/c1-2-3-9-12-10-13(14-15-12)11-7-5-4-6-8-11/h4-8,10,12,14H,2-3,9H2,1H3 |
| InChIKey | RFCKXNOXLTUGGO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |