C10H11NO — CID 57044806
3-benzyl-2,5-dihydro-1,2-oxazole (PubChem CID 57044806) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 3-benzyl-2,5-dihydro-1,2-oxazole.
| Compound Name | 3-benzyl-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 57044806 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 3-benzyl-2,5-dihydro-1,2-oxazole |
| SMILES | C1=C(Cc2ccccc2)NOC1 |
| InChI | InChI=1S/C10H11NO/c1-2-4-9(5-3-1)8-10-6-7-12-11-10/h1-6,11H,7-8H2 |
| InChIKey | KWEGICLYQSJKII-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |