C19H19F2NO — CID 57118295
3-[4,4-bis(4-fluorophenyl)butyl]-2,5-dihydro-1,2-oxazole (PubChem CID 57118295) has the molecular formula C19H19F2NO and a molecular weight of 315.36 g/mol. Its IUPAC name is 3-[4,4-bis(4-fluorophenyl)butyl]-2,5-dihydro-1,2-oxazole.
| Compound Name | 3-[4,4-bis(4-fluorophenyl)butyl]-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 57118295 |
| Molecular Formula | C19H19F2NO |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3-[4,4-bis(4-fluorophenyl)butyl]-2,5-dihydro-1,2-oxazole |
| SMILES | Fc1ccc(C(CCCC2=CCON2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H19F2NO/c20-16-8-4-14(5-9-16)19(15-6-10-17(21)11-7-15)3-1-2-18-12-13-23-22-18/h4-12,19,22H,1-3,13H2 |
| InChIKey | KCBBMUUBJIJSJN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |