C13H11F6NO2 — CID 91585031
1,1,1,3,3,3-hexafluoro-2-[3-(4-methylphenyl)-2,5-dihydro-1,2-oxazol-4-yl]propan-2-ol (PubChem CID 91585031) has the molecular formula C13H11F6NO2 and a molecular weight of 327.22 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[3-(4-methylphenyl)-2,5-dihydro-1,2-oxazol-4-yl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[3-(4-methylphenyl)-2,5-dihydro-1,2-oxazol-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 91585031 |
| Molecular Formula | C13H11F6NO2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[3-(4-methylphenyl)-2,5-dihydro-1,2-oxazol-4-yl]propan-2-ol |
| SMILES | Cc1ccc(C2=C(C(O)(C(F)(F)F)C(F)(F)F)CON2)cc1 |
| InChI | InChI=1S/C13H11F6NO2/c1-7-2-4-8(5-3-7)10-9(6-22-20-10)11(21,12(14,15)16)13(17,18)19/h2-5,20-21H,6H2,1H3 |
| InChIKey | ZKSBHBYTFGSRNM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |