C17H26N2 — CID 143029270
1-cyclohepta-1,3,6-trien-1-yl-N-[(1-propan-2-ylpiperidin-4-yl)methyl]methanimine (PubChem CID 143029270) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-cyclohepta-1,3,6-trien-1-yl-N-[(1-propan-2-ylpiperidin-4-yl)methyl]methanimine.
| Compound Name | 1-cyclohepta-1,3,6-trien-1-yl-N-[(1-propan-2-ylpiperidin-4-yl)methyl]methanimine |
|---|---|
| PubChem CID | 143029270 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 1-cyclohepta-1,3,6-trien-1-yl-N-[(1-propan-2-ylpiperidin-4-yl)methyl]methanimine |
| SMILES | CC(C)N1CCC(C/N=C/C2=CC=CCC=C2)CC1 |
| InChI | InChI=1S/C17H26N2/c1-15(2)19-11-9-17(10-12-19)14-18-13-16-7-5-3-4-6-8-16/h3,5-8,13,15,17H,4,9-12,14H2,1-2H3/b18-13+ |
| InChIKey | PVCIDPZMAPEANB-QGOAFFKASA-N |
| XLogP | 3.62 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|