About (2Z,4E)-N-(1-methylpiperidin-4-yl)-2-propan-2-ylhexa-2,4-dien-1-imine
(2Z,4E)-N-(1-methylpiperidin-4-yl)-2-propan-2-ylhexa-2,4-dien-1-imine (PubChem CID 144610727) has the molecular formula C15H26N2
and a molecular weight of 234.39 g/mol. Its IUPAC name is (2Z,4E)-N-(1-methylpiperidin-4-yl)-2-propan-2-ylhexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | (2Z,4E)-N-(1-methylpiperidin-4-yl)-2-propan-2-ylhexa-2,4-dien-1-imine |
| PubChem CID | 144610727 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | (2Z,4E)-N-(1-methylpiperidin-4-yl)-2-propan-2-ylhexa-2,4-dien-1-imine |
| SMILES | C/C=C/C=C(\C=N\C1CCN(C)CC1)C(C)C |
| InChI | InChI=1S/C15H26N2/c1-5-6-7-14(13(2)3)12-16-15-8-10-17(4)11-9-15/h5-7,12-13,15H,8-11H2,1-4H3/b6-5+,14-7+,16-12+ |
| InChIKey | QMEONAHDJZOJHJ-PHJJHUJESA-N |
| XLogP | 3.31 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-N-(1-methylpiperidin-4-yl)-2-propan-2-ylhexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-N-(1-methylpiperidin-4-yl)-2-propan-2-ylhexa-2,4-dien-1-imine?
The IUPAC name of (2Z,4E)-N-(1-methylpiperidin-4-yl)-2-propan-2-ylhexa-2,4-dien-1-imine (CID 144610727) is (2Z,4E)-N-(1-methylpiperidin-4-yl)-2-propan-2-ylhexa-2,4-dien-1-imine.
What is the SMILES notation for (2Z,4E)-N-(1-methylpiperidin-4-yl)-2-propan-2-ylhexa-2,4-dien-1-imine?
The canonical SMILES for (2Z,4E)-N-(1-methylpiperidin-4-yl)-2-propan-2-ylhexa-2,4-dien-1-imine is C/C=C/C=C(\C=N\C1CCN(C)CC1)C(C)C.
What is the InChIKey of (2Z,4E)-N-(1-methylpiperidin-4-yl)-2-propan-2-ylhexa-2,4-dien-1-imine?
The InChIKey is QMEONAHDJZOJHJ-PHJJHUJESA-N. The full InChI is InChI=1S/C15H26N2/c1-5-6-7-14(13(2)3)12-16-15-8-10-17(4)11-9-15/h5-7,12-13,15H,8-11H2,1-4H3/b6-5+,14-7+,16-12+.
What are the key properties of (2Z,4E)-N-(1-methylpiperidin-4-yl)-2-propan-2-ylhexa-2,4-dien-1-imine?
(2Z,4E)-N-(1-methylpiperidin-4-yl)-2-propan-2-ylhexa-2,4-dien-1-imine has a molecular weight of 234.39 g/mol, XLogP of 3.31, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-N-(1-methylpiperidin-4-yl)-2-propan-2-ylhexa-2,4-dien-1-imine is sourced from PubChem (CID 144610727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).