C19H28N2 — CID 166855694
(2Z)-N-methyl-1-(4-methylcyclohexa-2,4-dien-1-yl)-4-(piperidin-1-ylmethyl)penta-2,4-dien-1-imine (PubChem CID 166855694) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is (2Z)-N-methyl-1-(4-methylcyclohexa-2,4-dien-1-yl)-4-(piperidin-1-ylmethyl)penta-2,4-dien-1-imine.
| Compound Name | (2Z)-N-methyl-1-(4-methylcyclohexa-2,4-dien-1-yl)-4-(piperidin-1-ylmethyl)penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 166855694 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | (2Z)-N-methyl-1-(4-methylcyclohexa-2,4-dien-1-yl)-4-(piperidin-1-ylmethyl)penta-2,4-dien-1-imine |
| SMILES | C=C(/C=C\C(=N\C)C1C=CC(C)=CC1)CN1CCCCC1 |
| InChI | InChI=1S/C19H28N2/c1-16-7-10-18(11-8-16)19(20-3)12-9-17(2)15-21-13-5-4-6-14-21/h7-10,12,18H,2,4-6,11,13-15H2,1,3H3/b12-9-,20-19- |
| InChIKey | WHRWSKRKJODRDD-QRCHURJTSA-N |
| XLogP | 4.18 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|