C19H27NOS — CID 143029400
(Z)-3-[(Z)-but-2-enyl]-N-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)hept-5-enamide (PubChem CID 143029400) has the molecular formula C19H27NOS and a molecular weight of 317.50 g/mol. Its IUPAC name is (Z)-3-[(Z)-but-2-enyl]-N-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)hept-5-enamide.
| Compound Name | (Z)-3-[(Z)-but-2-enyl]-N-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)hept-5-enamide |
|---|---|
| PubChem CID | 143029400 |
| Molecular Formula | C19H27NOS |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (Z)-3-[(Z)-but-2-enyl]-N-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)hept-5-enamide |
| SMILES | C/C=C\CC(C/C=C\C)CC(=O)Nc1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C19H27NOS/c1-3-5-9-15(10-6-4-2)13-18(21)20-19-14-16-11-7-8-12-17(16)22-19/h3-6,14-15H,7-13H2,1-2H3,(H,20,21)/b5-3-,6-4- |
| InChIKey | RPQDEZXNNNWQAS-GLIMQPGKSA-N |
| XLogP | 5.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|