C28H40N2O4 — CID 143029935
ethane;(E,4Z)-2-ethenyl-4-[4-[4-(ethylcarbamoyl)phenyl]-1-oxa-9-azaspiro[5.5]undec-4-en-3-ylidene]but-2-enoic acid (PubChem CID 143029935) has the molecular formula C28H40N2O4 and a molecular weight of 468.64 g/mol. Its IUPAC name is ethane;(E,4Z)-2-ethenyl-4-[4-[4-(ethylcarbamoyl)phenyl]-1-oxa-9-azaspiro[5.5]undec-4-en-3-ylidene]but-2-enoic acid.
| Compound Name | ethane;(E,4Z)-2-ethenyl-4-[4-[4-(ethylcarbamoyl)phenyl]-1-oxa-9-azaspiro[5.5]undec-4-en-3-ylidene]but-2-enoic acid |
|---|---|
| PubChem CID | 143029935 |
| Molecular Formula | C28H40N2O4 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | ethane;(E,4Z)-2-ethenyl-4-[4-[4-(ethylcarbamoyl)phenyl]-1-oxa-9-azaspiro[5.5]undec-4-en-3-ylidene]but-2-enoic acid |
| SMILES | C=C/C(=C\C=C1/COC2(C=C1c1ccc(C(=O)NCC)cc1)CCNCC2)C(=O)O.CC.CC |
| InChI | InChI=1S/C24H28N2O4.2C2H6/c1-3-17(23(28)29)5-10-20-16-30-24(11-13-25-14-12-24)15-21(20)18-6-8-19(9-7-18)22(27)26-4-2;2*1-2/h3,5-10,15,25H,1,4,11-14,16H2,2H3,(H,26,27)(H,28,29);2*1-2H3/b17-5+,20-10+;; |
| InChIKey | LWKLNHOSDLIIRE-ZVBQFXSKSA-N |
| XLogP | 5.15 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|