C21H27N — CID 143032513
2-(2-ethyl-4-prop-1-en-2-ylphenyl)-3-methylpyridine;methylcyclopropane (PubChem CID 143032513) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is 2-(2-ethyl-4-prop-1-en-2-ylphenyl)-3-methylpyridine;methylcyclopropane.
| Compound Name | 2-(2-ethyl-4-prop-1-en-2-ylphenyl)-3-methylpyridine;methylcyclopropane |
|---|---|
| PubChem CID | 143032513 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 2-(2-ethyl-4-prop-1-en-2-ylphenyl)-3-methylpyridine;methylcyclopropane |
| SMILES | C=C(C)c1ccc(-c2ncccc2C)c(CC)c1.CC1CC1 |
| InChI | InChI=1S/C17H19N.C4H8/c1-5-14-11-15(12(2)3)8-9-16(14)17-13(4)7-6-10-18-17;1-4-2-3-4/h6-11H,2,5H2,1,3-4H3;4H,2-3H2,1H3 |
| InChIKey | LVPZHYMPPRGQSU-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |