C18H24N2O — CID 143033221
ethyl (2Z,4Z)-2-[1-(2-phenylethylamino)ethenyl]hexa-2,4-dienimidate (PubChem CID 143033221) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is ethyl (2Z,4Z)-2-[1-(2-phenylethylamino)ethenyl]hexa-2,4-dienimidate.
| Compound Name | ethyl (2Z,4Z)-2-[1-(2-phenylethylamino)ethenyl]hexa-2,4-dienimidate |
|---|---|
| PubChem CID | 143033221 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | ethyl (2Z,4Z)-2-[1-(2-phenylethylamino)ethenyl]hexa-2,4-dienimidate |
| SMILES | [H]/N=C(OCC)/C(=C\C=C/C)C(=C)NCCc1ccccc1 |
| InChI | InChI=1S/C18H24N2O/c1-4-6-12-17(18(19)21-5-2)15(3)20-14-13-16-10-8-7-9-11-16/h4,6-12,19-20H,3,5,13-14H2,1-2H3/b6-4-,17-12-,19-18- |
| InChIKey | NVJNTFXAIFXUMD-QPSANMBVSA-N |
| XLogP | 3.85 |
| TPSA | 45.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|