C13H10N2O4 — CID 143034956
N-[[5-(1-oxo-3H-2-benzofuran-5-yl)furan-2-yl]amino]formamide (PubChem CID 143034956) has the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. Its IUPAC name is N-[[5-(1-oxo-3H-2-benzofuran-5-yl)furan-2-yl]amino]formamide.
| Compound Name | N-[[5-(1-oxo-3H-2-benzofuran-5-yl)furan-2-yl]amino]formamide |
|---|---|
| PubChem CID | 143034956 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | N-[[5-(1-oxo-3H-2-benzofuran-5-yl)furan-2-yl]amino]formamide |
| SMILES | O=CNNc1ccc(-c2ccc3c(c2)COC3=O)o1 |
| InChI | InChI=1S/C13H10N2O4/c16-7-14-15-12-4-3-11(19-12)8-1-2-10-9(5-8)6-18-13(10)17/h1-5,7,15H,6H2,(H,14,16) |
| InChIKey | SXCVPFLHZNOYRB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|