C16H9NO5 — CID 50884174
(E)-2-cyano-3-[5-(1-oxo-3H-2-benzofuran-5-yl)furan-2-yl]prop-2-enoic acid (PubChem CID 50884174) has the molecular formula C16H9NO5 and a molecular weight of 295.25 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-(1-oxo-3H-2-benzofuran-5-yl)furan-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-(1-oxo-3H-2-benzofuran-5-yl)furan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 50884174 |
| Molecular Formula | C16H9NO5 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | (E)-2-cyano-3-[5-(1-oxo-3H-2-benzofuran-5-yl)furan-2-yl]prop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2ccc3c(c2)COC3=O)o1)C(=O)O |
| InChI | InChI=1S/C16H9NO5/c17-7-10(15(18)19)6-12-2-4-14(22-12)9-1-3-13-11(5-9)8-21-16(13)20/h1-6H,8H2,(H,18,19)/b10-6+ |
| InChIKey | BHFMTQAGTUPIMV-UXBLZVDNSA-N |
| XLogP | 2.61 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|