C22H27N5OS — CID 143037319
N-(3,5-dimethylphenyl)-2-(morpholin-4-ylmethyl)-2,3,4,5-tetrahydro-[1,3]thiazolo[4,5-h]quinazolin-8-amine (PubChem CID 143037319) has the molecular formula C22H27N5OS and a molecular weight of 409.56 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-(morpholin-4-ylmethyl)-2,3,4,5-tetrahydro-[1,3]thiazolo[4,5-h]quinazolin-8-amine.
| Compound Name | N-(3,5-dimethylphenyl)-2-(morpholin-4-ylmethyl)-2,3,4,5-tetrahydro-[1,3]thiazolo[4,5-h]quinazolin-8-amine |
|---|---|
| PubChem CID | 143037319 |
| Molecular Formula | C22H27N5OS |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-(morpholin-4-ylmethyl)-2,3,4,5-tetrahydro-[1,3]thiazolo[4,5-h]quinazolin-8-amine |
| SMILES | Cc1cc(C)cc(Nc2ncc3c(n2)C2=C(CC3)NC(CN3CCOCC3)S2)c1 |
| InChI | InChI=1S/C22H27N5OS/c1-14-9-15(2)11-17(10-14)24-22-23-12-16-3-4-18-21(20(16)26-22)29-19(25-18)13-27-5-7-28-8-6-27/h9-12,19,25H,3-8,13H2,1-2H3,(H,23,24,26) |
| InChIKey | WDTXLPLYRDRNBB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |