C16H14N4O2S2 — CID 163919450
8-(3-sulfanylanilino)-2,3,4,5-tetrahydro-[1,3]thiazolo[4,5-h]quinazoline-2-carboxylic acid (PubChem CID 163919450) has the molecular formula C16H14N4O2S2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 8-(3-sulfanylanilino)-2,3,4,5-tetrahydro-[1,3]thiazolo[4,5-h]quinazoline-2-carboxylic acid.
| Compound Name | 8-(3-sulfanylanilino)-2,3,4,5-tetrahydro-[1,3]thiazolo[4,5-h]quinazoline-2-carboxylic acid |
|---|---|
| PubChem CID | 163919450 |
| Molecular Formula | C16H14N4O2S2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 8-(3-sulfanylanilino)-2,3,4,5-tetrahydro-[1,3]thiazolo[4,5-h]quinazoline-2-carboxylic acid |
| SMILES | O=C(O)C1NC2=C(S1)c1nc(Nc3cccc(S)c3)ncc1CC2 |
| InChI | InChI=1S/C16H14N4O2S2/c21-15(22)14-19-11-5-4-8-7-17-16(20-12(8)13(11)24-14)18-9-2-1-3-10(23)6-9/h1-3,6-7,14,19,23H,4-5H2,(H,21,22)(H,17,18,20) |
| InChIKey | QZDNZYRJBWKNER-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|