C20H22N6OS2 — CID 143037354
piperazin-1-yl-[8-(3-sulfanylanilino)-4,5-dihydro-[1,3]thiazolo[5,4-h]quinazolin-2-yl]methanol (PubChem CID 143037354) has the molecular formula C20H22N6OS2 and a molecular weight of 426.57 g/mol. Its IUPAC name is piperazin-1-yl-[8-(3-sulfanylanilino)-4,5-dihydro-[1,3]thiazolo[5,4-h]quinazolin-2-yl]methanol.
| Compound Name | piperazin-1-yl-[8-(3-sulfanylanilino)-4,5-dihydro-[1,3]thiazolo[5,4-h]quinazolin-2-yl]methanol |
|---|---|
| PubChem CID | 143037354 |
| Molecular Formula | C20H22N6OS2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | piperazin-1-yl-[8-(3-sulfanylanilino)-4,5-dihydro-[1,3]thiazolo[5,4-h]quinazolin-2-yl]methanol |
| SMILES | OC(c1nc2c(s1)CCc1cnc(Nc3cccc(S)c3)nc1-2)N1CCNCC1 |
| InChI | InChI=1S/C20H22N6OS2/c27-19(26-8-6-21-7-9-26)18-24-17-15(29-18)5-4-12-11-22-20(25-16(12)17)23-13-2-1-3-14(28)10-13/h1-3,10-11,19,21,27-28H,4-9H2,(H,22,23,25) |
| InChIKey | UERBAWCPINUYKT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|