C20H21N7OS2 — CID 89125840
[8-(3-aminosulfanylanilino)-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazolin-2-yl]-piperazin-1-ylmethanone (PubChem CID 89125840) has the molecular formula C20H21N7OS2 and a molecular weight of 439.57 g/mol. Its IUPAC name is [8-(3-aminosulfanylanilino)-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazolin-2-yl]-piperazin-1-ylmethanone.
| Compound Name | [8-(3-aminosulfanylanilino)-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazolin-2-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 89125840 |
| Molecular Formula | C20H21N7OS2 |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | [8-(3-aminosulfanylanilino)-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazolin-2-yl]-piperazin-1-ylmethanone |
| SMILES | NSc1cccc(Nc2ncc3c(n2)-c2sc(C(=O)N4CCNCC4)nc2CC3)c1 |
| InChI | InChI=1S/C20H21N7OS2/c21-30-14-3-1-2-13(10-14)24-20-23-11-12-4-5-15-17(16(12)26-20)29-18(25-15)19(28)27-8-6-22-7-9-27/h1-3,10-11,22H,4-9,21H2,(H,23,24,26) |
| InChIKey | RJVUJLSAUPCGSA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|