C20H20N5OS3+ — CID 143037321
[3-[[4-(piperazine-1-carbonyl)-5,8-dithia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]phenyl]sulfanium (PubChem CID 143037321) has the molecular formula C20H20N5OS3+ and a molecular weight of 442.62 g/mol. Its IUPAC name is [3-[[4-(piperazine-1-carbonyl)-5,8-dithia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]phenyl]sulfanium.
| Compound Name | [3-[[4-(piperazine-1-carbonyl)-5,8-dithia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]phenyl]sulfanium |
|---|---|
| PubChem CID | 143037321 |
| Molecular Formula | C20H20N5OS3+ |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | [3-[[4-(piperazine-1-carbonyl)-5,8-dithia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]phenyl]sulfanium |
| SMILES | O=C(c1cc2c(s1)CSc1cnc(Nc3cccc([SH2+])c3)nc1-2)N1CCNCC1 |
| InChI | InChI=1S/C20H19N5OS3/c26-19(25-6-4-21-5-7-25)15-9-14-17(29-15)11-28-16-10-22-20(24-18(14)16)23-12-2-1-3-13(27)8-12/h1-3,8-10,21,27H,4-7,11H2,(H,22,23,24)/p+1 |
| InChIKey | HEOQCWZRXHEACJ-UHFFFAOYSA-O |
| XLogP | 2.97 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|