C22H23N5OS2 — CID 59262707
[12-(3,5-dimethylanilino)-5,8-dithia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-4-yl]-piperazin-1-ylmethanone (PubChem CID 59262707) has the molecular formula C22H23N5OS2 and a molecular weight of 437.59 g/mol. Its IUPAC name is [12-(3,5-dimethylanilino)-5,8-dithia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-4-yl]-piperazin-1-ylmethanone.
| Compound Name | [12-(3,5-dimethylanilino)-5,8-dithia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-4-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 59262707 |
| Molecular Formula | C22H23N5OS2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | [12-(3,5-dimethylanilino)-5,8-dithia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-4-yl]-piperazin-1-ylmethanone |
| SMILES | Cc1cc(C)cc(Nc2ncc3c(n2)-c2cc(C(=O)N4CCNCC4)sc2CS3)c1 |
| InChI | InChI=1S/C22H23N5OS2/c1-13-7-14(2)9-15(8-13)25-22-24-11-18-20(26-22)16-10-17(30-19(16)12-29-18)21(28)27-5-3-23-4-6-27/h7-11,23H,3-6,12H2,1-2H3,(H,24,25,26) |
| InChIKey | QEXOIGSNIAKFOB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |