C28H25N5OS — CID 59262751
[2-(3-benzylanilino)thieno[2,3-h]quinazolin-8-yl]-piperazin-1-ylmethanone (PubChem CID 59262751) has the molecular formula C28H25N5OS and a molecular weight of 479.61 g/mol. Its IUPAC name is [2-(3-benzylanilino)thieno[2,3-h]quinazolin-8-yl]-piperazin-1-ylmethanone.
| Compound Name | [2-(3-benzylanilino)thieno[2,3-h]quinazolin-8-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 59262751 |
| Molecular Formula | C28H25N5OS |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | [2-(3-benzylanilino)thieno[2,3-h]quinazolin-8-yl]-piperazin-1-ylmethanone |
| SMILES | O=C(c1cc2c(ccc3cnc(Nc4cccc(Cc5ccccc5)c4)nc32)s1)N1CCNCC1 |
| InChI | InChI=1S/C28H25N5OS/c34-27(33-13-11-29-12-14-33)25-17-23-24(35-25)10-9-21-18-30-28(32-26(21)23)31-22-8-4-7-20(16-22)15-19-5-2-1-3-6-19/h1-10,16-18,29H,11-15H2,(H,30,31,32) |
| InChIKey | MLLMTSZZLVEQDC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |