C21H19N5O3S2 — CID 70947123
3-[[8-(3-aminopyrrolidine-1-carbonyl)thieno[2,3-h]quinazolin-2-yl]amino]benzenesulfinic acid (PubChem CID 70947123) has the molecular formula C21H19N5O3S2 and a molecular weight of 453.55 g/mol. Its IUPAC name is 3-[[8-(3-aminopyrrolidine-1-carbonyl)thieno[2,3-h]quinazolin-2-yl]amino]benzenesulfinic acid.
| Compound Name | 3-[[8-(3-aminopyrrolidine-1-carbonyl)thieno[2,3-h]quinazolin-2-yl]amino]benzenesulfinic acid |
|---|---|
| PubChem CID | 70947123 |
| Molecular Formula | C21H19N5O3S2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 3-[[8-(3-aminopyrrolidine-1-carbonyl)thieno[2,3-h]quinazolin-2-yl]amino]benzenesulfinic acid |
| SMILES | NC1CCN(C(=O)c2cc3c(ccc4cnc(Nc5cccc(S(=O)O)c5)nc43)s2)C1 |
| InChI | InChI=1S/C21H19N5O3S2/c22-13-6-7-26(11-13)20(27)18-9-16-17(30-18)5-4-12-10-23-21(25-19(12)16)24-14-2-1-3-15(8-14)31(28)29/h1-5,8-10,13H,6-7,11,22H2,(H,28,29)(H,23,24,25) |
| InChIKey | YDBMNWIIUPOSBN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|